C26H44O4SSi — CID 88621177
2-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]propyl 4-methylbenzenesulfonate (PubChem CID 88621177) has the molecular formula C26H44O4SSi and a molecular weight of 480.79 g/mol. Its IUPAC name is 2-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]propyl 4-methylbenzenesulfonate.
| Compound Name | 2-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]propyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 88621177 |
| Molecular Formula | C26H44O4SSi |
| Molecular Weight | 480.79 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | 2-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]propyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(C)[C@H]2CC[C@H]3[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]23C)cc1 |
| InChI | InChI=1S/C26H44O4SSi/c1-19-11-13-21(14-12-19)31(27,28)29-18-20(2)22-15-16-23-24(10-9-17-26(22,23)6)30-32(7,8)25(3,4)5/h11-14,20,22-24H,9-10,15-18H2,1-8H3/t20?,22-,23+,24+,26-/m1/s1 |
| InChIKey | YPZVZHFTOWMQHV-YHRAJFLFSA-N |
| XLogP | 6.94 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.79 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|