About 3-O-tert-butyl 1-O-ethyl 2-chloro-2-(6-chloro-5-fluoropyridine-3-carbonyl)propanedioate
3-O-tert-butyl 1-O-ethyl 2-chloro-2-(6-chloro-5-fluoropyridine-3-carbonyl)propanedioate (PubChem CID 88621322) has the molecular formula C15H16Cl2FNO5
and a molecular weight of 380.20 g/mol. Its IUPAC name is 3-O-tert-butyl 1-O-ethyl 2-chloro-2-(6-chloro-5-fluoropyridine-3-carbonyl)propanedioate.
Molecular Properties
| Compound Name | 3-O-tert-butyl 1-O-ethyl 2-chloro-2-(6-chloro-5-fluoropyridine-3-carbonyl)propanedioate |
| PubChem CID | 88621322 |
| Molecular Formula | C15H16Cl2FNO5 |
| Molecular Weight | 380.20 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | 3-O-tert-butyl 1-O-ethyl 2-chloro-2-(6-chloro-5-fluoropyridine-3-carbonyl)propanedioate |
| SMILES | CCOC(=O)C(Cl)(C(=O)OC(C)(C)C)C(=O)c1cnc(Cl)c(F)c1 |
| InChI | InChI=1S/C15H16Cl2FNO5/c1-5-23-12(21)15(17,13(22)24-14(2,3)4)10(20)8-6-9(18)11(16)19-7-8/h6-7H,5H2,1-4H3 |
| InChIKey | HJLDGZDQFXDEPS-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 82.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.20 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-O-tert-butyl 1-O-ethyl 2-chloro-2-(6-chloro-5-fluoropyridine-3-carbonyl)propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-O-tert-butyl 1-O-ethyl 2-chloro-2-(6-chloro-5-fluoropyridine-3-carbonyl)propanedioate?
The IUPAC name of 3-O-tert-butyl 1-O-ethyl 2-chloro-2-(6-chloro-5-fluoropyridine-3-carbonyl)propanedioate (CID 88621322) is 3-O-tert-butyl 1-O-ethyl 2-chloro-2-(6-chloro-5-fluoropyridine-3-carbonyl)propanedioate.
What is the SMILES notation for 3-O-tert-butyl 1-O-ethyl 2-chloro-2-(6-chloro-5-fluoropyridine-3-carbonyl)propanedioate?
The canonical SMILES for 3-O-tert-butyl 1-O-ethyl 2-chloro-2-(6-chloro-5-fluoropyridine-3-carbonyl)propanedioate is CCOC(=O)C(Cl)(C(=O)OC(C)(C)C)C(=O)c1cnc(Cl)c(F)c1.
What is the InChIKey of 3-O-tert-butyl 1-O-ethyl 2-chloro-2-(6-chloro-5-fluoropyridine-3-carbonyl)propanedioate?
The InChIKey is HJLDGZDQFXDEPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16Cl2FNO5/c1-5-23-12(21)15(17,13(22)24-14(2,3)4)10(20)8-6-9(18)11(16)19-7-8/h6-7H,5H2,1-4H3.
What are the key properties of 3-O-tert-butyl 1-O-ethyl 2-chloro-2-(6-chloro-5-fluoropyridine-3-carbonyl)propanedioate?
3-O-tert-butyl 1-O-ethyl 2-chloro-2-(6-chloro-5-fluoropyridine-3-carbonyl)propanedioate has a molecular weight of 380.20 g/mol, XLogP of 2.94, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-O-tert-butyl 1-O-ethyl 2-chloro-2-(6-chloro-5-fluoropyridine-3-carbonyl)propanedioate is sourced from PubChem (CID 88621322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).