C24H39N3O7 — CID 88621462
[2-[2-[[2-[[2-hydroxy-3-(4-hydroxy-2,3,5-trimethylphenoxy)propyl]amino]-2-methylpropyl]amino]-2-oxoethyl]cyclohexyl] nitrate (PubChem CID 88621462) has the molecular formula C24H39N3O7 and a molecular weight of 481.59 g/mol. Its IUPAC name is [2-[2-[[2-[[2-hydroxy-3-(4-hydroxy-2,3,5-trimethylphenoxy)propyl]amino]-2-methylpropyl]amino]-2-oxoethyl]cyclohexyl] nitrate.
| Compound Name | [2-[2-[[2-[[2-hydroxy-3-(4-hydroxy-2,3,5-trimethylphenoxy)propyl]amino]-2-methylpropyl]amino]-2-oxoethyl]cyclohexyl] nitrate |
|---|---|
| PubChem CID | 88621462 |
| Molecular Formula | C24H39N3O7 |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.28 |
| IUPAC Name | [2-[2-[[2-[[2-hydroxy-3-(4-hydroxy-2,3,5-trimethylphenoxy)propyl]amino]-2-methylpropyl]amino]-2-oxoethyl]cyclohexyl] nitrate |
| SMILES | Cc1cc(OCC(O)CNC(C)(C)CNC(=O)CC2CCCCC2O[N+](=O)[O-])c(C)c(C)c1O |
| InChI | InChI=1S/C24H39N3O7/c1-15-10-21(16(2)17(3)23(15)30)33-13-19(28)12-26-24(4,5)14-25-22(29)11-18-8-6-7-9-20(18)34-27(31)32/h10,18-20,26,28,30H,6-9,11-14H2,1-5H3,(H,25,29) |
| InChIKey | MTILPVQDBKTWTM-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 143.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|