C21H35N3O7 — CID 88621475
[5-[[2-[[2-hydroxy-3-(4-hydroxy-2,3,5-trimethylphenoxy)propyl]amino]-2-methylpropyl]amino]-5-oxopentan-2-yl] nitrate (PubChem CID 88621475) has the molecular formula C21H35N3O7 and a molecular weight of 441.53 g/mol. Its IUPAC name is [5-[[2-[[2-hydroxy-3-(4-hydroxy-2,3,5-trimethylphenoxy)propyl]amino]-2-methylpropyl]amino]-5-oxopentan-2-yl] nitrate.
| Compound Name | [5-[[2-[[2-hydroxy-3-(4-hydroxy-2,3,5-trimethylphenoxy)propyl]amino]-2-methylpropyl]amino]-5-oxopentan-2-yl] nitrate |
|---|---|
| PubChem CID | 88621475 |
| Molecular Formula | C21H35N3O7 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | [5-[[2-[[2-hydroxy-3-(4-hydroxy-2,3,5-trimethylphenoxy)propyl]amino]-2-methylpropyl]amino]-5-oxopentan-2-yl] nitrate |
| SMILES | Cc1cc(OCC(O)CNC(C)(C)CNC(=O)CCC(C)O[N+](=O)[O-])c(C)c(C)c1O |
| InChI | InChI=1S/C21H35N3O7/c1-13-9-18(15(3)16(4)20(13)27)30-11-17(25)10-23-21(5,6)12-22-19(26)8-7-14(2)31-24(28)29/h9,14,17,23,25,27H,7-8,10-12H2,1-6H3,(H,22,26) |
| InChIKey | JXACAKBZFXVXMM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 143.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|