C23H35N3O8 — CID 88621489
[4-[2-hydroxy-3-[2-[(4-nitrooxycyclohexanecarbonyl)amino]ethylamino]propoxy]-2,3,6-trimethylphenyl] acetate (PubChem CID 88621489) has the molecular formula C23H35N3O8 and a molecular weight of 481.55 g/mol. Its IUPAC name is [4-[2-hydroxy-3-[2-[(4-nitrooxycyclohexanecarbonyl)amino]ethylamino]propoxy]-2,3,6-trimethylphenyl] acetate.
| Compound Name | [4-[2-hydroxy-3-[2-[(4-nitrooxycyclohexanecarbonyl)amino]ethylamino]propoxy]-2,3,6-trimethylphenyl] acetate |
|---|---|
| PubChem CID | 88621489 |
| Molecular Formula | C23H35N3O8 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | [4-[2-hydroxy-3-[2-[(4-nitrooxycyclohexanecarbonyl)amino]ethylamino]propoxy]-2,3,6-trimethylphenyl] acetate |
| SMILES | CC(=O)Oc1c(C)cc(OCC(O)CNCCNC(=O)C2CCC(O[N+](=O)[O-])CC2)c(C)c1C |
| InChI | InChI=1S/C23H35N3O8/c1-14-11-21(15(2)16(3)22(14)33-17(4)27)32-13-19(28)12-24-9-10-25-23(29)18-5-7-20(8-6-18)34-26(30)31/h11,18-20,24,28H,5-10,12-13H2,1-4H3,(H,25,29) |
| InChIKey | MBYYMVGCBWWWFU-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 149.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|