C23H37N3O8 — CID 88621546
[4-[2-hydroxy-3-[[2-methyl-1-(5-nitrooxypentanoylamino)propan-2-yl]amino]propoxy]-2,3,6-trimethylphenyl] acetate (PubChem CID 88621546) has the molecular formula C23H37N3O8 and a molecular weight of 483.56 g/mol. Its IUPAC name is [4-[2-hydroxy-3-[[2-methyl-1-(5-nitrooxypentanoylamino)propan-2-yl]amino]propoxy]-2,3,6-trimethylphenyl] acetate.
| Compound Name | [4-[2-hydroxy-3-[[2-methyl-1-(5-nitrooxypentanoylamino)propan-2-yl]amino]propoxy]-2,3,6-trimethylphenyl] acetate |
|---|---|
| PubChem CID | 88621546 |
| Molecular Formula | C23H37N3O8 |
| Molecular Weight | 483.56 g/mol |
| Exact Mass | 483.26 |
| IUPAC Name | [4-[2-hydroxy-3-[[2-methyl-1-(5-nitrooxypentanoylamino)propan-2-yl]amino]propoxy]-2,3,6-trimethylphenyl] acetate |
| SMILES | CC(=O)Oc1c(C)cc(OCC(O)CNC(C)(C)CNC(=O)CCCCO[N+](=O)[O-])c(C)c1C |
| InChI | InChI=1S/C23H37N3O8/c1-15-11-20(16(2)17(3)22(15)34-18(4)27)32-13-19(28)12-25-23(5,6)14-24-21(29)9-7-8-10-33-26(30)31/h11,19,25,28H,7-10,12-14H2,1-6H3,(H,24,29) |
| InChIKey | SERSDGJAWSAJAB-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 149.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.56 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|