C20H22N2O7 — CID 88621702
(6E)-9-ethyl-6-methoxyimino-4-oxo-10-propyl-7,8-dihydropyrano[3,2-g]quinoline-2,8-dicarboxylic acid (PubChem CID 88621702) has the molecular formula C20H22N2O7 and a molecular weight of 402.40 g/mol. Its IUPAC name is (6E)-9-ethyl-6-methoxyimino-4-oxo-10-propyl-7,8-dihydropyrano[3,2-g]quinoline-2,8-dicarboxylic acid.
| Compound Name | (6E)-9-ethyl-6-methoxyimino-4-oxo-10-propyl-7,8-dihydropyrano[3,2-g]quinoline-2,8-dicarboxylic acid |
|---|---|
| PubChem CID | 88621702 |
| Molecular Formula | C20H22N2O7 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | (6E)-9-ethyl-6-methoxyimino-4-oxo-10-propyl-7,8-dihydropyrano[3,2-g]quinoline-2,8-dicarboxylic acid |
| SMILES | CCCc1c2c(cc3c(=O)cc(C(=O)O)oc13)/C(=N/OC)CC(C(=O)O)N2CC |
| InChI | InChI=1S/C20H22N2O7/c1-4-6-10-17-11(7-12-15(23)9-16(20(26)27)29-18(10)12)13(21-28-3)8-14(19(24)25)22(17)5-2/h7,9,14H,4-6,8H2,1-3H3,(H,24,25)(H,26,27)/b21-13+ |
| InChIKey | VOTOOLXNRSENFX-FYJGNVAPSA-N |
| XLogP | 2.48 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|