C15H36N3O3+3 — CID 88622121
trimethyl-[2,4,6-trihydroxy-3,5-bis(trimethylazaniumyl)cyclohexyl]azanium (PubChem CID 88622121) has the molecular formula C15H36N3O3+3 and a molecular weight of 306.47 g/mol. Its IUPAC name is trimethyl-[2,4,6-trihydroxy-3,5-bis(trimethylazaniumyl)cyclohexyl]azanium.
| Compound Name | trimethyl-[2,4,6-trihydroxy-3,5-bis(trimethylazaniumyl)cyclohexyl]azanium |
|---|---|
| PubChem CID | 88622121 |
| Molecular Formula | C15H36N3O3+3 |
| Molecular Weight | 306.47 g/mol |
| Exact Mass | 306.27 |
| IUPAC Name | trimethyl-[2,4,6-trihydroxy-3,5-bis(trimethylazaniumyl)cyclohexyl]azanium |
| SMILES | C[N+](C)(C)C1C(O)C([N+](C)(C)C)C(O)C([N+](C)(C)C)C1O |
| InChI | InChI=1S/C15H36N3O3/c1-16(2,3)10-13(19)11(17(4,5)6)15(21)12(14(10)20)18(7,8)9/h10-15,19-21H,1-9H3/q+3 |
| InChIKey | NQEJTOOSPLDWEB-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.47 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|