About 6-(oxomethylidene)cyclohexa-2,4-diene-1-sulfonamide
6-(oxomethylidene)cyclohexa-2,4-diene-1-sulfonamide (PubChem CID 88622167) has the molecular formula C7H7NO3S
and a molecular weight of 185.20 g/mol. Its IUPAC name is 6-(oxomethylidene)cyclohexa-2,4-diene-1-sulfonamide.
Molecular Properties
| Compound Name | 6-(oxomethylidene)cyclohexa-2,4-diene-1-sulfonamide |
| PubChem CID | 88622167 |
| Molecular Formula | C7H7NO3S |
| Molecular Weight | 185.20 g/mol |
| Exact Mass | 185.01 |
| IUPAC Name | 6-(oxomethylidene)cyclohexa-2,4-diene-1-sulfonamide |
| SMILES | NS(=O)(=O)C1C=CC=CC1=C=O |
| InChI | InChI=1S/C7H7NO3S/c8-12(10,11)7-4-2-1-3-6(7)5-9/h1-4,7H,(H2,8,10,11) |
| InChIKey | SNKMEYYFSDDFNZ-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.20 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|
Analyze 6-(oxomethylidene)cyclohexa-2,4-diene-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(oxomethylidene)cyclohexa-2,4-diene-1-sulfonamide?
The IUPAC name of 6-(oxomethylidene)cyclohexa-2,4-diene-1-sulfonamide (CID 88622167) is 6-(oxomethylidene)cyclohexa-2,4-diene-1-sulfonamide.
What is the SMILES notation for 6-(oxomethylidene)cyclohexa-2,4-diene-1-sulfonamide?
The canonical SMILES for 6-(oxomethylidene)cyclohexa-2,4-diene-1-sulfonamide is NS(=O)(=O)C1C=CC=CC1=C=O.
What is the InChIKey of 6-(oxomethylidene)cyclohexa-2,4-diene-1-sulfonamide?
The InChIKey is SNKMEYYFSDDFNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO3S/c8-12(10,11)7-4-2-1-3-6(7)5-9/h1-4,7H,(H2,8,10,11).
What are the key properties of 6-(oxomethylidene)cyclohexa-2,4-diene-1-sulfonamide?
6-(oxomethylidene)cyclohexa-2,4-diene-1-sulfonamide has a molecular weight of 185.20 g/mol, XLogP of -0.47, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(oxomethylidene)cyclohexa-2,4-diene-1-sulfonamide is sourced from PubChem (CID 88622167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).