About 5-hexan-3-yl-6-oxocyclohexa-1,3-diene-1-carbaldehyde
5-hexan-3-yl-6-oxocyclohexa-1,3-diene-1-carbaldehyde (PubChem CID 88622403) has the molecular formula C13H18O2
and a molecular weight of 206.29 g/mol. Its IUPAC name is 5-hexan-3-yl-6-oxocyclohexa-1,3-diene-1-carbaldehyde.
Molecular Properties
| Compound Name | 5-hexan-3-yl-6-oxocyclohexa-1,3-diene-1-carbaldehyde |
| PubChem CID | 88622403 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 5-hexan-3-yl-6-oxocyclohexa-1,3-diene-1-carbaldehyde |
| SMILES | CCCC(CC)C1C=CC=C(C=O)C1=O |
| InChI | InChI=1S/C13H18O2/c1-3-6-10(4-2)12-8-5-7-11(9-14)13(12)15/h5,7-10,12H,3-4,6H2,1-2H3 |
| InChIKey | NRQHXXMXSKGNKX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 5-hexan-3-yl-6-oxocyclohexa-1,3-diene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hexan-3-yl-6-oxocyclohexa-1,3-diene-1-carbaldehyde?
The IUPAC name of 5-hexan-3-yl-6-oxocyclohexa-1,3-diene-1-carbaldehyde (CID 88622403) is 5-hexan-3-yl-6-oxocyclohexa-1,3-diene-1-carbaldehyde.
What is the SMILES notation for 5-hexan-3-yl-6-oxocyclohexa-1,3-diene-1-carbaldehyde?
The canonical SMILES for 5-hexan-3-yl-6-oxocyclohexa-1,3-diene-1-carbaldehyde is CCCC(CC)C1C=CC=C(C=O)C1=O.
What is the InChIKey of 5-hexan-3-yl-6-oxocyclohexa-1,3-diene-1-carbaldehyde?
The InChIKey is NRQHXXMXSKGNKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O2/c1-3-6-10(4-2)12-8-5-7-11(9-14)13(12)15/h5,7-10,12H,3-4,6H2,1-2H3.
What are the key properties of 5-hexan-3-yl-6-oxocyclohexa-1,3-diene-1-carbaldehyde?
5-hexan-3-yl-6-oxocyclohexa-1,3-diene-1-carbaldehyde has a molecular weight of 206.29 g/mol, XLogP of 2.69, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hexan-3-yl-6-oxocyclohexa-1,3-diene-1-carbaldehyde is sourced from PubChem (CID 88622403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).