C24H32N4O8S — CID 88622524
(E)-4-benzoyloxy-4-oxobut-2-enoic acid;(2S)-1-(tert-butylamino)-3-[(4-morpholin-4-yl-1,2,5-thiadiazol-3-yl)oxy]propan-2-ol (PubChem CID 88622524) has the molecular formula C24H32N4O8S and a molecular weight of 536.61 g/mol. Its IUPAC name is (E)-4-benzoyloxy-4-oxobut-2-enoic acid;(2S)-1-(tert-butylamino)-3-[(4-morpholin-4-yl-1,2,5-thiadiazol-3-yl)oxy]propan-2-ol.
| Compound Name | (E)-4-benzoyloxy-4-oxobut-2-enoic acid;(2S)-1-(tert-butylamino)-3-[(4-morpholin-4-yl-1,2,5-thiadiazol-3-yl)oxy]propan-2-ol |
|---|---|
| PubChem CID | 88622524 |
| Molecular Formula | C24H32N4O8S |
| Molecular Weight | 536.61 g/mol |
| Exact Mass | 536.19 |
| IUPAC Name | (E)-4-benzoyloxy-4-oxobut-2-enoic acid;(2S)-1-(tert-butylamino)-3-[(4-morpholin-4-yl-1,2,5-thiadiazol-3-yl)oxy]propan-2-ol |
| SMILES | CC(C)(C)NC[C@H](O)COc1nsnc1N1CCOCC1.O=C(O)/C=C/C(=O)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C13H24N4O3S.C11H8O5/c1-13(2,3)14-8-10(18)9-20-12-11(15-21-16-12)17-4-6-19-7-5-17;12-9(13)6-7-10(14)16-11(15)8-4-2-1-3-5-8/h10,14,18H,4-9H2,1-3H3;1-7H,(H,12,13)/b;7-6+/t10-;/m0./s1 |
| InChIKey | YZRGYNNDQKIEPP-VDQNXCGCSA-N |
| XLogP | 1.51 |
| TPSA | 160.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.61 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|