C11H11NO5S — CID 88622525
7-(oxiran-2-ylmethoxy)-1-benzofuran-2-sulfonamide (PubChem CID 88622525) has the molecular formula C11H11NO5S and a molecular weight of 269.28 g/mol. Its IUPAC name is 7-(oxiran-2-ylmethoxy)-1-benzofuran-2-sulfonamide.
| Compound Name | 7-(oxiran-2-ylmethoxy)-1-benzofuran-2-sulfonamide |
|---|---|
| PubChem CID | 88622525 |
| Molecular Formula | C11H11NO5S |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 7-(oxiran-2-ylmethoxy)-1-benzofuran-2-sulfonamide |
| SMILES | NS(=O)(=O)c1cc2cccc(OCC3CO3)c2o1 |
| InChI | InChI=1S/C11H11NO5S/c12-18(13,14)10-4-7-2-1-3-9(11(7)17-10)16-6-8-5-15-8/h1-4,8H,5-6H2,(H2,12,13,14) |
| InChIKey | CAAQOTGFDZJASR-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|