C43H42N4O5 — CID 88622598
3-butanoyl-4-(4-hydroxy-2-methylanilino)quinoline-8-carbaldehyde;1-[8-ethenyl-4-(4-hydroxy-2-methylanilino)quinolin-3-yl]butan-1-one (PubChem CID 88622598) has the molecular formula C43H42N4O5 and a molecular weight of 694.83 g/mol. Its IUPAC name is 3-butanoyl-4-(4-hydroxy-2-methylanilino)quinoline-8-carbaldehyde;1-[8-ethenyl-4-(4-hydroxy-2-methylanilino)quinolin-3-yl]butan-1-one.
| Compound Name | 3-butanoyl-4-(4-hydroxy-2-methylanilino)quinoline-8-carbaldehyde;1-[8-ethenyl-4-(4-hydroxy-2-methylanilino)quinolin-3-yl]butan-1-one |
|---|---|
| PubChem CID | 88622598 |
| Molecular Formula | C43H42N4O5 |
| Molecular Weight | 694.83 g/mol |
| Exact Mass | 694.32 |
| IUPAC Name | 3-butanoyl-4-(4-hydroxy-2-methylanilino)quinoline-8-carbaldehyde;1-[8-ethenyl-4-(4-hydroxy-2-methylanilino)quinolin-3-yl]butan-1-one |
| SMILES | C=Cc1cccc2c(Nc3ccc(O)cc3C)c(C(=O)CCC)cnc12.CCCC(=O)c1cnc2c(C=O)cccc2c1Nc1ccc(O)cc1C |
| InChI | InChI=1S/C22H22N2O2.C21H20N2O3/c1-4-7-20(26)18-13-23-21-15(5-2)8-6-9-17(21)22(18)24-19-11-10-16(25)12-14(19)3;1-3-5-19(26)17-11-22-20-14(12-24)6-4-7-16(20)21(17)23-18-9-8-15(25)10-13(18)2/h5-6,8-13,25H,2,4,7H2,1,3H3,(H,23,24);4,6-12,25H,3,5H2,1-2H3,(H,22,23) |
| InChIKey | CHMXZXUPSVNRCI-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 141.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.83 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|