C14H22N2O3 — CID 88622660
2-[(butan-2-ylamino)methyl]benzoic acid;N-methylformamide (PubChem CID 88622660) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is 2-[(butan-2-ylamino)methyl]benzoic acid;N-methylformamide.
| Compound Name | 2-[(butan-2-ylamino)methyl]benzoic acid;N-methylformamide |
|---|---|
| PubChem CID | 88622660 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 2-[(butan-2-ylamino)methyl]benzoic acid;N-methylformamide |
| SMILES | CCC(C)NCc1ccccc1C(=O)O.CNC=O |
| InChI | InChI=1S/C12H17NO2.C2H5NO/c1-3-9(2)13-8-10-6-4-5-7-11(10)12(14)15;1-3-2-4/h4-7,9,13H,3,8H2,1-2H3,(H,14,15);2H,1H3,(H,3,4) |
| InChIKey | UIWXPRAASKGWRM-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|