About 3-bromofuran-2-carbonyl bromide
3-bromofuran-2-carbonyl bromide (PubChem CID 88622824) has the molecular formula C5H2Br2O2
and a molecular weight of 253.88 g/mol. Its IUPAC name is 3-bromofuran-2-carbonyl bromide.
Molecular Properties
| Compound Name | 3-bromofuran-2-carbonyl bromide |
| PubChem CID | 88622824 |
| Molecular Formula | C5H2Br2O2 |
| Molecular Weight | 253.88 g/mol |
| Exact Mass | 251.84 |
| IUPAC Name | 3-bromofuran-2-carbonyl bromide |
| SMILES | O=C(Br)c1occc1Br |
| InChI | InChI=1S/C5H2Br2O2/c6-3-1-2-9-4(3)5(7)8/h1-2H |
| InChIKey | RUFXWDGLUHGXIV-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.88 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-bromofuran-2-carbonyl bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromofuran-2-carbonyl bromide?
The IUPAC name of 3-bromofuran-2-carbonyl bromide (CID 88622824) is 3-bromofuran-2-carbonyl bromide.
What is the SMILES notation for 3-bromofuran-2-carbonyl bromide?
The canonical SMILES for 3-bromofuran-2-carbonyl bromide is O=C(Br)c1occc1Br.
What is the InChIKey of 3-bromofuran-2-carbonyl bromide?
The InChIKey is RUFXWDGLUHGXIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H2Br2O2/c6-3-1-2-9-4(3)5(7)8/h1-2H.
What are the key properties of 3-bromofuran-2-carbonyl bromide?
3-bromofuran-2-carbonyl bromide has a molecular weight of 253.88 g/mol, XLogP of 2.58, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromofuran-2-carbonyl bromide is sourced from PubChem (CID 88622824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).