About 2-butan-2-yl-4,6-dimethyl-1,3,5-dithiazinane
2-butan-2-yl-4,6-dimethyl-1,3,5-dithiazinane (PubChem CID 88622901) has the molecular formula C9H19NS2
and a molecular weight of 205.39 g/mol. Its IUPAC name is 2-butan-2-yl-4,6-dimethyl-1,3,5-dithiazinane.
Molecular Properties
| Compound Name | 2-butan-2-yl-4,6-dimethyl-1,3,5-dithiazinane |
| PubChem CID | 88622901 |
| Molecular Formula | C9H19NS2 |
| Molecular Weight | 205.39 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | 2-butan-2-yl-4,6-dimethyl-1,3,5-dithiazinane |
| SMILES | CCC(C)C1SC(C)NC(C)S1 |
| InChI | InChI=1S/C9H19NS2/c1-5-6(2)9-11-7(3)10-8(4)12-9/h6-10H,5H2,1-4H3 |
| InChIKey | BLDFHTPIEUHZJY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-butan-2-yl-4,6-dimethyl-1,3,5-dithiazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butan-2-yl-4,6-dimethyl-1,3,5-dithiazinane?
The IUPAC name of 2-butan-2-yl-4,6-dimethyl-1,3,5-dithiazinane (CID 88622901) is 2-butan-2-yl-4,6-dimethyl-1,3,5-dithiazinane.
What is the SMILES notation for 2-butan-2-yl-4,6-dimethyl-1,3,5-dithiazinane?
The canonical SMILES for 2-butan-2-yl-4,6-dimethyl-1,3,5-dithiazinane is CCC(C)C1SC(C)NC(C)S1.
What is the InChIKey of 2-butan-2-yl-4,6-dimethyl-1,3,5-dithiazinane?
The InChIKey is BLDFHTPIEUHZJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NS2/c1-5-6(2)9-11-7(3)10-8(4)12-9/h6-10H,5H2,1-4H3.
What are the key properties of 2-butan-2-yl-4,6-dimethyl-1,3,5-dithiazinane?
2-butan-2-yl-4,6-dimethyl-1,3,5-dithiazinane has a molecular weight of 205.39 g/mol, XLogP of 3.12, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butan-2-yl-4,6-dimethyl-1,3,5-dithiazinane is sourced from PubChem (CID 88622901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).