C19H14ClNO3S — CID 88622906
5-[[2-[(3-chlorophenyl)methyl]-1-benzofuran-5-yl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 88622906) has the molecular formula C19H14ClNO3S and a molecular weight of 371.85 g/mol. Its IUPAC name is 5-[[2-[(3-chlorophenyl)methyl]-1-benzofuran-5-yl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[2-[(3-chlorophenyl)methyl]-1-benzofuran-5-yl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 88622906 |
| Molecular Formula | C19H14ClNO3S |
| Molecular Weight | 371.85 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | 5-[[2-[(3-chlorophenyl)methyl]-1-benzofuran-5-yl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(Cc2ccc3oc(Cc4cccc(Cl)c4)cc3c2)S1 |
| InChI | InChI=1S/C19H14ClNO3S/c20-14-3-1-2-11(7-14)8-15-10-13-6-12(4-5-16(13)24-15)9-17-18(22)21-19(23)25-17/h1-7,10,17H,8-9H2,(H,21,22,23) |
| InChIKey | YBICRUCAXKUFMO-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.85 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|