About Dihydro-2,4-dimethyl-6-(1-methylpropyl)-4H-1,3,5-dithiazine
Dihydro-2,4-dimethyl-6-(1-methylpropyl)-4H-1,3,5-dithiazine (PubChem CID 88623012) has the molecular formula C9H19NS2
and a molecular weight of 205.40 g/mol. Its IUPAC name is 4-butan-2-yl-2,6-dimethyl-1,3,5-dithiazinane.
Molecular Properties
| Compound Name | Dihydro-2,4-dimethyl-6-(1-methylpropyl)-4H-1,3,5-dithiazine |
| PubChem CID | 88623012 |
| Molecular Formula | C9H19NS2 |
| Molecular Weight | 205.40 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | 4-butan-2-yl-2,6-dimethyl-1,3,5-dithiazinane |
| SMILES | CCC(C)C1NC(SC(S1)C)C |
| InChI | InChI=1S/C9H19NS2/c1-5-6(2)9-10-7(3)11-8(4)12-9/h6-10H,5H2,1-4H3 |
| InChIKey | WONMKWKUDGYZEA-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 62.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | 140 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.40 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze Dihydro-2,4-dimethyl-6-(1-methylpropyl)-4H-1,3,5-dithiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Dihydro-2,4-dimethyl-6-(1-methylpropyl)-4H-1,3,5-dithiazine?
The IUPAC name of Dihydro-2,4-dimethyl-6-(1-methylpropyl)-4H-1,3,5-dithiazine (CID 88623012) is 4-butan-2-yl-2,6-dimethyl-1,3,5-dithiazinane.
What is the SMILES notation for Dihydro-2,4-dimethyl-6-(1-methylpropyl)-4H-1,3,5-dithiazine?
The canonical SMILES for Dihydro-2,4-dimethyl-6-(1-methylpropyl)-4H-1,3,5-dithiazine is CCC(C)C1NC(SC(S1)C)C.
What is the InChIKey of Dihydro-2,4-dimethyl-6-(1-methylpropyl)-4H-1,3,5-dithiazine?
The InChIKey is WONMKWKUDGYZEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NS2/c1-5-6(2)9-10-7(3)11-8(4)12-9/h6-10H,5H2,1-4H3.
What are the key properties of Dihydro-2,4-dimethyl-6-(1-methylpropyl)-4H-1,3,5-dithiazine?
Dihydro-2,4-dimethyl-6-(1-methylpropyl)-4H-1,3,5-dithiazine has a molecular weight of 205.40 g/mol, XLogP of 3.80, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Dihydro-2,4-dimethyl-6-(1-methylpropyl)-4H-1,3,5-dithiazine is sourced from PubChem (CID 88623012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).