C23H34O7S — CID 88623122
2-[(1R,2S,4R)-2-(cyclohexylmethoxy)-4-methoxy-6,8-dioxabicyclo[3.2.1]octan-5-yl]ethyl 4-methylbenzenesulfonate (PubChem CID 88623122) has the molecular formula C23H34O7S and a molecular weight of 454.59 g/mol. Its IUPAC name is 2-[(1R,2S,4R)-2-(cyclohexylmethoxy)-4-methoxy-6,8-dioxabicyclo[3.2.1]octan-5-yl]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[(1R,2S,4R)-2-(cyclohexylmethoxy)-4-methoxy-6,8-dioxabicyclo[3.2.1]octan-5-yl]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 88623122 |
| Molecular Formula | C23H34O7S |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | 2-[(1R,2S,4R)-2-(cyclohexylmethoxy)-4-methoxy-6,8-dioxabicyclo[3.2.1]octan-5-yl]ethyl 4-methylbenzenesulfonate |
| SMILES | CO[C@@H]1C[C@H](OCC2CCCCC2)[C@H]2COC1(CCOS(=O)(=O)c1ccc(C)cc1)O2 |
| InChI | InChI=1S/C23H34O7S/c1-17-8-10-19(11-9-17)31(24,25)29-13-12-23-22(26-2)14-20(21(30-23)16-28-23)27-15-18-6-4-3-5-7-18/h8-11,18,20-22H,3-7,12-16H2,1-2H3/t20-,21+,22+,23?/m0/s1 |
| InChIKey | HCQPAYAQVXCTLR-PZKXETHGSA-N |
| XLogP | 3.59 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|