C9H9N — CID 88623123
1,1a,2,3-tetrahydroindeno[1,2-b]azirine (PubChem CID 88623123) has the molecular formula C9H9N and a molecular weight of 131.18 g/mol. Its IUPAC name is 1,1a,2,3-tetrahydroindeno[1,2-b]azirine.
| Compound Name | 1,1a,2,3-tetrahydroindeno[1,2-b]azirine |
|---|---|
| PubChem CID | 88623123 |
| Molecular Formula | C9H9N |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.07 |
| IUPAC Name | 1,1a,2,3-tetrahydroindeno[1,2-b]azirine |
| SMILES | C1=CC2=C(CC1)C1NC1=C2 |
| InChI | InChI=1S/C9H9N/c1-2-4-7-6(3-1)5-8-9(7)10-8/h1,3,5,9-10H,2,4H2 |
| InChIKey | NUSGZSSYYHDWTL-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 21.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|