C6H2F3N3O6 — CID 88623210
1,5,6-trifluoro-2,4,6-trinitrocyclohexa-1,3-diene (PubChem CID 88623210) has the molecular formula C6H2F3N3O6 and a molecular weight of 269.09 g/mol. Its IUPAC name is 1,5,6-trifluoro-2,4,6-trinitrocyclohexa-1,3-diene.
| Compound Name | 1,5,6-trifluoro-2,4,6-trinitrocyclohexa-1,3-diene |
|---|---|
| PubChem CID | 88623210 |
| Molecular Formula | C6H2F3N3O6 |
| Molecular Weight | 269.09 g/mol |
| Exact Mass | 268.99 |
| IUPAC Name | 1,5,6-trifluoro-2,4,6-trinitrocyclohexa-1,3-diene |
| SMILES | O=[N+]([O-])C1=CC([N+](=O)[O-])=C(F)C(F)([N+](=O)[O-])C1F |
| InChI | InChI=1S/C6H2F3N3O6/c7-4-2(10(13)14)1-3(11(15)16)5(8)6(4,9)12(17)18/h1,4H |
| InChIKey | TWANVTNZSTXSNW-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 129.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.09 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|