About cyclohexane;5-methyl-2-benzofuran-1,3-dione
cyclohexane;5-methyl-2-benzofuran-1,3-dione (PubChem CID 88623758) has the molecular formula C15H18O3
and a molecular weight of 246.31 g/mol. Its IUPAC name is cyclohexane;5-methyl-2-benzofuran-1,3-dione.
Molecular Properties
| Compound Name | cyclohexane;5-methyl-2-benzofuran-1,3-dione |
| PubChem CID | 88623758 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | cyclohexane;5-methyl-2-benzofuran-1,3-dione |
| SMILES | C1CCCCC1.Cc1ccc2c(c1)C(=O)OC2=O |
| InChI | InChI=1S/C9H6O3.C6H12/c1-5-2-3-6-7(4-5)9(11)12-8(6)10;1-2-4-6-5-3-1/h2-4H,1H3;1-6H2 |
| InChIKey | RFKUPBRTFVHHMA-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze cyclohexane;5-methyl-2-benzofuran-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexane;5-methyl-2-benzofuran-1,3-dione?
The IUPAC name of cyclohexane;5-methyl-2-benzofuran-1,3-dione (CID 88623758) is cyclohexane;5-methyl-2-benzofuran-1,3-dione.
What is the SMILES notation for cyclohexane;5-methyl-2-benzofuran-1,3-dione?
The canonical SMILES for cyclohexane;5-methyl-2-benzofuran-1,3-dione is C1CCCCC1.Cc1ccc2c(c1)C(=O)OC2=O.
What is the InChIKey of cyclohexane;5-methyl-2-benzofuran-1,3-dione?
The InChIKey is RFKUPBRTFVHHMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6O3.C6H12/c1-5-2-3-6-7(4-5)9(11)12-8(6)10;1-2-4-6-5-3-1/h2-4H,1H3;1-6H2.
What are the key properties of cyclohexane;5-methyl-2-benzofuran-1,3-dione?
cyclohexane;5-methyl-2-benzofuran-1,3-dione has a molecular weight of 246.31 g/mol, XLogP of 3.65, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexane;5-methyl-2-benzofuran-1,3-dione is sourced from PubChem (CID 88623758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).