About methyl 2-[4-(6-carbamothioyl-4,5-dihydro-3H-pyridazin-2-yl)-3-chloro-5-fluorothiophen-2-yl]acetate
methyl 2-[4-(6-carbamothioyl-4,5-dihydro-3H-pyridazin-2-yl)-3-chloro-5-fluorothiophen-2-yl]acetate (PubChem CID 88624200) has the molecular formula C12H13ClFN3O2S2
and a molecular weight of 349.84 g/mol. Its IUPAC name is methyl 2-[4-(6-carbamothioyl-4,5-dihydro-3H-pyridazin-2-yl)-3-chloro-5-fluorothiophen-2-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[4-(6-carbamothioyl-4,5-dihydro-3H-pyridazin-2-yl)-3-chloro-5-fluorothiophen-2-yl]acetate |
| PubChem CID | 88624200 |
| Molecular Formula | C12H13ClFN3O2S2 |
| Molecular Weight | 349.84 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | methyl 2-[4-(6-carbamothioyl-4,5-dihydro-3H-pyridazin-2-yl)-3-chloro-5-fluorothiophen-2-yl]acetate |
| SMILES | COC(=O)Cc1sc(F)c(N2CCCC(C(N)=S)=N2)c1Cl |
| InChI | InChI=1S/C12H13ClFN3O2S2/c1-19-8(18)5-7-9(13)10(11(14)21-7)17-4-2-3-6(16-17)12(15)20/h2-5H2,1H3,(H2,15,20) |
| InChIKey | RNQKUVWORKMHOK-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.84 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[4-(6-carbamothioyl-4,5-dihydro-3H-pyridazin-2-yl)-3-chloro-5-fluorothiophen-2-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[4-(6-carbamothioyl-4,5-dihydro-3H-pyridazin-2-yl)-3-chloro-5-fluorothiophen-2-yl]acetate?
The IUPAC name of methyl 2-[4-(6-carbamothioyl-4,5-dihydro-3H-pyridazin-2-yl)-3-chloro-5-fluorothiophen-2-yl]acetate (CID 88624200) is methyl 2-[4-(6-carbamothioyl-4,5-dihydro-3H-pyridazin-2-yl)-3-chloro-5-fluorothiophen-2-yl]acetate.
What is the SMILES notation for methyl 2-[4-(6-carbamothioyl-4,5-dihydro-3H-pyridazin-2-yl)-3-chloro-5-fluorothiophen-2-yl]acetate?
The canonical SMILES for methyl 2-[4-(6-carbamothioyl-4,5-dihydro-3H-pyridazin-2-yl)-3-chloro-5-fluorothiophen-2-yl]acetate is COC(=O)Cc1sc(F)c(N2CCCC(C(N)=S)=N2)c1Cl.
What is the InChIKey of methyl 2-[4-(6-carbamothioyl-4,5-dihydro-3H-pyridazin-2-yl)-3-chloro-5-fluorothiophen-2-yl]acetate?
The InChIKey is RNQKUVWORKMHOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClFN3O2S2/c1-19-8(18)5-7-9(13)10(11(14)21-7)17-4-2-3-6(16-17)12(15)20/h2-5H2,1H3,(H2,15,20).
What are the key properties of methyl 2-[4-(6-carbamothioyl-4,5-dihydro-3H-pyridazin-2-yl)-3-chloro-5-fluorothiophen-2-yl]acetate?
methyl 2-[4-(6-carbamothioyl-4,5-dihydro-3H-pyridazin-2-yl)-3-chloro-5-fluorothiophen-2-yl]acetate has a molecular weight of 349.84 g/mol, XLogP of 2.50, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[4-(6-carbamothioyl-4,5-dihydro-3H-pyridazin-2-yl)-3-chloro-5-fluorothiophen-2-yl]acetate is sourced from PubChem (CID 88624200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).