About 1-aminopropan-2-ol;prop-2-enyl hydrogen sulfate
1-aminopropan-2-ol;prop-2-enyl hydrogen sulfate (PubChem CID 88624304) has the molecular formula C6H15NO5S
and a molecular weight of 213.25 g/mol. Its IUPAC name is 1-aminopropan-2-ol;prop-2-enyl hydrogen sulfate.
Molecular Properties
| Compound Name | 1-aminopropan-2-ol;prop-2-enyl hydrogen sulfate |
| PubChem CID | 88624304 |
| Molecular Formula | C6H15NO5S |
| Molecular Weight | 213.25 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | 1-aminopropan-2-ol;prop-2-enyl hydrogen sulfate |
| SMILES | C=CCOS(=O)(=O)O.CC(O)CN |
| InChI | InChI=1S/C3H9NO.C3H6O4S/c1-3(5)2-4;1-2-3-7-8(4,5)6/h3,5H,2,4H2,1H3;2H,1,3H2,(H,4,5,6) |
| InChIKey | SGXDNVZGXNYZQY-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.25 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-aminopropan-2-ol;prop-2-enyl hydrogen sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminopropan-2-ol;prop-2-enyl hydrogen sulfate?
The IUPAC name of 1-aminopropan-2-ol;prop-2-enyl hydrogen sulfate (CID 88624304) is 1-aminopropan-2-ol;prop-2-enyl hydrogen sulfate.
What is the SMILES notation for 1-aminopropan-2-ol;prop-2-enyl hydrogen sulfate?
The canonical SMILES for 1-aminopropan-2-ol;prop-2-enyl hydrogen sulfate is C=CCOS(=O)(=O)O.CC(O)CN.
What is the InChIKey of 1-aminopropan-2-ol;prop-2-enyl hydrogen sulfate?
The InChIKey is SGXDNVZGXNYZQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9NO.C3H6O4S/c1-3(5)2-4;1-2-3-7-8(4,5)6/h3,5H,2,4H2,1H3;2H,1,3H2,(H,4,5,6).
What are the key properties of 1-aminopropan-2-ol;prop-2-enyl hydrogen sulfate?
1-aminopropan-2-ol;prop-2-enyl hydrogen sulfate has a molecular weight of 213.25 g/mol, XLogP of -0.68, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminopropan-2-ol;prop-2-enyl hydrogen sulfate is sourced from PubChem (CID 88624304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).