C13H13N3OS — CID 88624545
1,6-dimethyl-1-sulfanyl-2,4-dihydropyrido[3,2-f][1,8]naphthyridin-3-one (PubChem CID 88624545) has the molecular formula C13H13N3OS and a molecular weight of 259.33 g/mol. Its IUPAC name is 1,6-dimethyl-1-sulfanyl-2,4-dihydropyrido[3,2-f][1,8]naphthyridin-3-one.
| Compound Name | 1,6-dimethyl-1-sulfanyl-2,4-dihydropyrido[3,2-f][1,8]naphthyridin-3-one |
|---|---|
| PubChem CID | 88624545 |
| Molecular Formula | C13H13N3OS |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 1,6-dimethyl-1-sulfanyl-2,4-dihydropyrido[3,2-f][1,8]naphthyridin-3-one |
| SMILES | Cc1nc2c(c3cccnc13)C(C)(S)CC(=O)N2 |
| InChI | InChI=1S/C13H13N3OS/c1-7-11-8(4-3-5-14-11)10-12(15-7)16-9(17)6-13(10,2)18/h3-5,18H,6H2,1-2H3,(H,15,16,17) |
| InChIKey | DPDJWFMTUOZUHX-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|