About dodecylsulfanylcarbamic acid
dodecylsulfanylcarbamic acid (PubChem CID 88625409) has the molecular formula C13H27NO2S
and a molecular weight of 261.43 g/mol. Its IUPAC name is dodecylsulfanylcarbamic acid.
Molecular Properties
| Compound Name | dodecylsulfanylcarbamic acid |
| PubChem CID | 88625409 |
| Molecular Formula | C13H27NO2S |
| Molecular Weight | 261.43 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | dodecylsulfanylcarbamic acid |
| SMILES | CCCCCCCCCCCCSNC(=O)O |
| InChI | InChI=1S/C13H27NO2S/c1-2-3-4-5-6-7-8-9-10-11-12-17-14-13(15)16/h14H,2-12H2,1H3,(H,15,16) |
| InChIKey | QWKWTFDDFYOABU-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.43 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze dodecylsulfanylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodecylsulfanylcarbamic acid?
The IUPAC name of dodecylsulfanylcarbamic acid (CID 88625409) is dodecylsulfanylcarbamic acid.
What is the SMILES notation for dodecylsulfanylcarbamic acid?
The canonical SMILES for dodecylsulfanylcarbamic acid is CCCCCCCCCCCCSNC(=O)O.
What is the InChIKey of dodecylsulfanylcarbamic acid?
The InChIKey is QWKWTFDDFYOABU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NO2S/c1-2-3-4-5-6-7-8-9-10-11-12-17-14-13(15)16/h14H,2-12H2,1H3,(H,15,16).
What are the key properties of dodecylsulfanylcarbamic acid?
dodecylsulfanylcarbamic acid has a molecular weight of 261.43 g/mol, XLogP of 4.82, 12 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dodecylsulfanylcarbamic acid is sourced from PubChem (CID 88625409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).