C22H36O3 — CID 88625564
9a-cyclooctyl-3a-methyl-4-propan-2-yl-4,5,6,7,8,9-hexahydrocycloocta[c]furan-1,3-dione (PubChem CID 88625564) has the molecular formula C22H36O3 and a molecular weight of 348.53 g/mol. Its IUPAC name is 9a-cyclooctyl-3a-methyl-4-propan-2-yl-4,5,6,7,8,9-hexahydrocycloocta[c]furan-1,3-dione.
| Compound Name | 9a-cyclooctyl-3a-methyl-4-propan-2-yl-4,5,6,7,8,9-hexahydrocycloocta[c]furan-1,3-dione |
|---|---|
| PubChem CID | 88625564 |
| Molecular Formula | C22H36O3 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.27 |
| IUPAC Name | 9a-cyclooctyl-3a-methyl-4-propan-2-yl-4,5,6,7,8,9-hexahydrocycloocta[c]furan-1,3-dione |
| SMILES | CC(C)C1CCCCCC2(C3CCCCCCC3)C(=O)OC(=O)C12C |
| InChI | InChI=1S/C22H36O3/c1-16(2)18-14-10-7-11-15-22(17-12-8-5-4-6-9-13-17)20(24)25-19(23)21(18,22)3/h16-18H,4-15H2,1-3H3 |
| InChIKey | QTHUJSUHXDRBTJ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|