C16H13N5O6S3 — CID 88625668
[5-[formyl-(5-hydroxy-4-oxo-1H-pyridin-2-yl)amino]-1,3,4-thiadiazol-2-yl]sulfanylmethyl (6S)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 88625668) has the molecular formula C16H13N5O6S3 and a molecular weight of 467.51 g/mol. Its IUPAC name is [5-[formyl-(5-hydroxy-4-oxo-1H-pyridin-2-yl)amino]-1,3,4-thiadiazol-2-yl]sulfanylmethyl (6S)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | [5-[formyl-(5-hydroxy-4-oxo-1H-pyridin-2-yl)amino]-1,3,4-thiadiazol-2-yl]sulfanylmethyl (6S)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88625668 |
| Molecular Formula | C16H13N5O6S3 |
| Molecular Weight | 467.51 g/mol |
| Exact Mass | 467.00 |
| IUPAC Name | [5-[formyl-(5-hydroxy-4-oxo-1H-pyridin-2-yl)amino]-1,3,4-thiadiazol-2-yl]sulfanylmethyl (6S)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | O=CN(c1cc(=O)c(O)c[nH]1)c1nnc(SCOC(=O)C2=CCS[C@H]3CC(=O)N23)s1 |
| InChI | InChI=1S/C16H13N5O6S3/c22-6-20(11-3-9(23)10(24)5-17-11)15-18-19-16(30-15)29-7-27-14(26)8-1-2-28-13-4-12(25)21(8)13/h1,3,5-6,13,24H,2,4,7H2,(H,17,23)/t13-/m0/s1 |
| InChIKey | CQNCROHXGSRUJB-ZDUSSCGKSA-N |
| XLogP | 1.01 |
| TPSA | 145.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.51 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|