C53H59ClN4O4 — CID 88625923
1,1,5,5-tetrakis[4-[bis(prop-2-enyl)amino]phenyl]penta-2,4-dienyl perchlorate (PubChem CID 88625923) has the molecular formula C53H59ClN4O4 and a molecular weight of 851.53 g/mol. Its IUPAC name is 1,1,5,5-tetrakis[4-[bis(prop-2-enyl)amino]phenyl]penta-2,4-dienyl perchlorate.
| Compound Name | 1,1,5,5-tetrakis[4-[bis(prop-2-enyl)amino]phenyl]penta-2,4-dienyl perchlorate |
|---|---|
| PubChem CID | 88625923 |
| Molecular Formula | C53H59ClN4O4 |
| Molecular Weight | 851.53 g/mol |
| Exact Mass | 850.42 |
| IUPAC Name | 1,1,5,5-tetrakis[4-[bis(prop-2-enyl)amino]phenyl]penta-2,4-dienyl perchlorate |
| SMILES | C=CCN(CC=C)c1ccc(C(=CC=CC(O[Cl+3]([O-])([O-])[O-])(c2ccc(N(CC=C)CC=C)cc2)c2ccc(N(CC=C)CC=C)cc2)c2ccc(N(CC=C)CC=C)cc2)cc1 |
| InChI | InChI=1S/C53H59ClN4O4/c1-9-36-55(37-10-2)48-27-19-44(20-28-48)52(45-21-29-49(30-22-45)56(38-11-3)39-12-4)18-17-35-53(62-54(59,60)61,46-23-31-50(32-24-46)57(40-13-5)41-14-6)47-25-33-51(34-26-47)58(42-15-7)43-16-8/h9-35H,1-8,36-43H2 |
| InChIKey | PSXOCQRCZZUWEG-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.53 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|