C28H32N2O4 — CID 88625934
(4R,7aR,12bS)-3-(cyclopropylmethyl)-7-(2,3-dimethylphenoxy)imino-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol (PubChem CID 88625934) has the molecular formula C28H32N2O4 and a molecular weight of 460.57 g/mol. Its IUPAC name is (4R,7aR,12bS)-3-(cyclopropylmethyl)-7-(2,3-dimethylphenoxy)imino-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol.
| Compound Name | (4R,7aR,12bS)-3-(cyclopropylmethyl)-7-(2,3-dimethylphenoxy)imino-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol |
|---|---|
| PubChem CID | 88625934 |
| Molecular Formula | C28H32N2O4 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | (4R,7aR,12bS)-3-(cyclopropylmethyl)-7-(2,3-dimethylphenoxy)imino-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol |
| SMILES | Cc1cccc(ON=C2CCC3(O)[C@H]4Cc5ccc(O)c6c5[C@@]3(CCN4CC3CC3)[C@H]2O6)c1C |
| InChI | InChI=1S/C28H32N2O4/c1-16-4-3-5-22(17(16)2)34-29-20-10-11-28(32)23-14-19-8-9-21(31)25-24(19)27(28,26(20)33-25)12-13-30(23)15-18-6-7-18/h3-5,8-9,18,23,26,31-32H,6-7,10-15H2,1-2H3/t23-,26+,27+,28?/m1/s1 |
| InChIKey | OIVWUGKLAPKZIG-ZEEGBIDFSA-N |
| XLogP | 4.01 |
| TPSA | 74.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|