C14F18 — CID 88625948
1,1,2,2,3,3,4,4,4a,4b,5,5,6,6,7,8,9,10-octadecafluorophenanthrene (PubChem CID 88625948) has the molecular formula C14F18 and a molecular weight of 510.12 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,4a,4b,5,5,6,6,7,8,9,10-octadecafluorophenanthrene.
| Compound Name | 1,1,2,2,3,3,4,4,4a,4b,5,5,6,6,7,8,9,10-octadecafluorophenanthrene |
|---|---|
| PubChem CID | 88625948 |
| Molecular Formula | C14F18 |
| Molecular Weight | 510.12 g/mol |
| Exact Mass | 509.97 |
| IUPAC Name | 1,1,2,2,3,3,4,4,4a,4b,5,5,6,6,7,8,9,10-octadecafluorophenanthrene |
| SMILES | FC1=C(F)C(F)(F)C(F)(F)C2(F)C1=C(F)C(F)=C1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C12F |
| InChI | InChI=1S/C14F18/c15-2-1-3(16)6(18)10(23,24)11(25,26)7(1,19)8(20)5(4(2)17)9(21,22)13(29,30)14(31,32)12(8,27)28 |
| InChIKey | IAXISWAAKLQRHM-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.12 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|