About N-(5-chloro-2-methyl-2,3-dihydro-1-benzofuran-7-carbonyl)-1-azabicyclo[2.2.2]octan-3-amine oxide
N-(5-chloro-2-methyl-2,3-dihydro-1-benzofuran-7-carbonyl)-1-azabicyclo[2.2.2]octan-3-amine oxide (PubChem CID 88626010) has the molecular formula C17H21ClN2O3
and a molecular weight of 336.82 g/mol. Its IUPAC name is N-(5-chloro-2-methyl-2,3-dihydro-1-benzofuran-7-carbonyl)-1-azabicyclo[2.2.2]octan-3-amine oxide.
Molecular Properties
| Compound Name | N-(5-chloro-2-methyl-2,3-dihydro-1-benzofuran-7-carbonyl)-1-azabicyclo[2.2.2]octan-3-amine oxide |
| PubChem CID | 88626010 |
| Molecular Formula | C17H21ClN2O3 |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | N-(5-chloro-2-methyl-2,3-dihydro-1-benzofuran-7-carbonyl)-1-azabicyclo[2.2.2]octan-3-amine oxide |
| SMILES | CC1Cc2cc(Cl)cc(C(=O)[NH+]([O-])C3CN4CCC3CC4)c2O1 |
| InChI | InChI=1S/C17H21ClN2O3/c1-10-6-12-7-13(18)8-14(16(12)23-10)17(21)20(22)15-9-19-4-2-11(15)3-5-19/h7-8,10-11,15,20H,2-6,9H2,1H3 |
| InChIKey | DNIBLZCXZYOFFJ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 57.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(5-chloro-2-methyl-2,3-dihydro-1-benzofuran-7-carbonyl)-1-azabicyclo[2.2.2]octan-3-amine oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-chloro-2-methyl-2,3-dihydro-1-benzofuran-7-carbonyl)-1-azabicyclo[2.2.2]octan-3-amine oxide?
The IUPAC name of N-(5-chloro-2-methyl-2,3-dihydro-1-benzofuran-7-carbonyl)-1-azabicyclo[2.2.2]octan-3-amine oxide (CID 88626010) is N-(5-chloro-2-methyl-2,3-dihydro-1-benzofuran-7-carbonyl)-1-azabicyclo[2.2.2]octan-3-amine oxide.
What is the SMILES notation for N-(5-chloro-2-methyl-2,3-dihydro-1-benzofuran-7-carbonyl)-1-azabicyclo[2.2.2]octan-3-amine oxide?
The canonical SMILES for N-(5-chloro-2-methyl-2,3-dihydro-1-benzofuran-7-carbonyl)-1-azabicyclo[2.2.2]octan-3-amine oxide is CC1Cc2cc(Cl)cc(C(=O)[NH+]([O-])C3CN4CCC3CC4)c2O1.
What is the InChIKey of N-(5-chloro-2-methyl-2,3-dihydro-1-benzofuran-7-carbonyl)-1-azabicyclo[2.2.2]octan-3-amine oxide?
The InChIKey is DNIBLZCXZYOFFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21ClN2O3/c1-10-6-12-7-13(18)8-14(16(12)23-10)17(21)20(22)15-9-19-4-2-11(15)3-5-19/h7-8,10-11,15,20H,2-6,9H2,1H3.
What are the key properties of N-(5-chloro-2-methyl-2,3-dihydro-1-benzofuran-7-carbonyl)-1-azabicyclo[2.2.2]octan-3-amine oxide?
N-(5-chloro-2-methyl-2,3-dihydro-1-benzofuran-7-carbonyl)-1-azabicyclo[2.2.2]octan-3-amine oxide has a molecular weight of 336.82 g/mol, XLogP of 1.28, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-chloro-2-methyl-2,3-dihydro-1-benzofuran-7-carbonyl)-1-azabicyclo[2.2.2]octan-3-amine oxide is sourced from PubChem (CID 88626010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).