About N-prop-2-enyl-2,9-dihydro-1H-phenalen-2-amine
N-prop-2-enyl-2,9-dihydro-1H-phenalen-2-amine (PubChem CID 88626018) has the molecular formula C16H17N
and a molecular weight of 223.32 g/mol. Its IUPAC name is N-prop-2-enyl-2,9-dihydro-1H-phenalen-2-amine.
Molecular Properties
| Compound Name | N-prop-2-enyl-2,9-dihydro-1H-phenalen-2-amine |
| PubChem CID | 88626018 |
| Molecular Formula | C16H17N |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | N-prop-2-enyl-2,9-dihydro-1H-phenalen-2-amine |
| SMILES | C=CCNC1C=c2cccc3c2=C(CC=C3)C1 |
| InChI | InChI=1S/C16H17N/c1-2-9-17-15-10-13-7-3-5-12-6-4-8-14(11-15)16(12)13/h2-7,10,15,17H,1,8-9,11H2 |
| InChIKey | PIRUCVGMWZYVQU-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-prop-2-enyl-2,9-dihydro-1H-phenalen-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-prop-2-enyl-2,9-dihydro-1H-phenalen-2-amine?
The IUPAC name of N-prop-2-enyl-2,9-dihydro-1H-phenalen-2-amine (CID 88626018) is N-prop-2-enyl-2,9-dihydro-1H-phenalen-2-amine.
What is the SMILES notation for N-prop-2-enyl-2,9-dihydro-1H-phenalen-2-amine?
The canonical SMILES for N-prop-2-enyl-2,9-dihydro-1H-phenalen-2-amine is C=CCNC1C=c2cccc3c2=C(CC=C3)C1.
What is the InChIKey of N-prop-2-enyl-2,9-dihydro-1H-phenalen-2-amine?
The InChIKey is PIRUCVGMWZYVQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N/c1-2-9-17-15-10-13-7-3-5-12-6-4-8-14(11-15)16(12)13/h2-7,10,15,17H,1,8-9,11H2.
What are the key properties of N-prop-2-enyl-2,9-dihydro-1H-phenalen-2-amine?
N-prop-2-enyl-2,9-dihydro-1H-phenalen-2-amine has a molecular weight of 223.32 g/mol, XLogP of 1.58, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-prop-2-enyl-2,9-dihydro-1H-phenalen-2-amine is sourced from PubChem (CID 88626018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).