C51H42N2O8 — CID 88626184
[4-methoxy-3-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]benzoyl] 2,6-dimethyl-4-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]benzoate (PubChem CID 88626184) has the molecular formula C51H42N2O8 and a molecular weight of 810.90 g/mol. Its IUPAC name is [4-methoxy-3-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]benzoyl] 2,6-dimethyl-4-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]benzoate.
| Compound Name | [4-methoxy-3-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]benzoyl] 2,6-dimethyl-4-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]benzoate |
|---|---|
| PubChem CID | 88626184 |
| Molecular Formula | C51H42N2O8 |
| Molecular Weight | 810.90 g/mol |
| Exact Mass | 810.29 |
| IUPAC Name | [4-methoxy-3-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]benzoyl] 2,6-dimethyl-4-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]benzoate |
| SMILES | COc1ccc(C(=O)OC(=O)c2c(C)cc(OCc3cccc(OCc4ccc5ccccc5n4)c3)cc2C)cc1OCc1cccc(OCc2ccc3ccccc3n2)c1 |
| InChI | InChI=1S/C51H42N2O8/c1-33-24-44(57-29-35-10-8-14-42(26-35)58-31-40-21-18-37-12-4-6-16-45(37)52-40)25-34(2)49(33)51(55)61-50(54)39-20-23-47(56-3)48(28-39)60-30-36-11-9-15-43(27-36)59-32-41-22-19-38-13-5-7-17-46(38)53-41/h4-28H,29-32H2,1-3H3 |
| InChIKey | OPZVYANGMNEZHT-UHFFFAOYSA-N |
| XLogP | 10.72 |
| TPSA | 115.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.90 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|