C13H14N2O — CID 88626516
9-amino-2,3,10,10a-tetrahydro-1H-acridin-4-one (PubChem CID 88626516) has the molecular formula C13H14N2O and a molecular weight of 214.27 g/mol. Its IUPAC name is 9-amino-2,3,10,10a-tetrahydro-1H-acridin-4-one.
| Compound Name | 9-amino-2,3,10,10a-tetrahydro-1H-acridin-4-one |
|---|---|
| PubChem CID | 88626516 |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 9-amino-2,3,10,10a-tetrahydro-1H-acridin-4-one |
| SMILES | NC1=C2C=CC=CC2NC2=C1CCCC2=O |
| InChI | InChI=1S/C13H14N2O/c14-12-8-4-1-2-6-10(8)15-13-9(12)5-3-7-11(13)16/h1-2,4,6,10,15H,3,5,7,14H2 |
| InChIKey | ZAAYOBAZHGWJOK-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |