About 1-(1-bromo-6,7-dimethylnaphthalen-2-yl)ethyl-triphenylphosphanium
1-(1-bromo-6,7-dimethylnaphthalen-2-yl)ethyl-triphenylphosphanium (PubChem CID 88627145) has the molecular formula C32H29BrP+
and a molecular weight of 524.46 g/mol. Its IUPAC name is 1-(1-bromo-6,7-dimethylnaphthalen-2-yl)ethyl-triphenylphosphanium.
Molecular Properties
| Compound Name | 1-(1-bromo-6,7-dimethylnaphthalen-2-yl)ethyl-triphenylphosphanium |
| PubChem CID | 88627145 |
| Molecular Formula | C32H29BrP+ |
| Molecular Weight | 524.46 g/mol |
| Exact Mass | 523.12 |
| IUPAC Name | 1-(1-bromo-6,7-dimethylnaphthalen-2-yl)ethyl-triphenylphosphanium |
| SMILES | Cc1cc2ccc(C(C)[P+](c3ccccc3)(c3ccccc3)c3ccccc3)c(Br)c2cc1C |
| InChI | InChI=1S/C32H29BrP/c1-23-21-26-19-20-30(32(33)31(26)22-24(23)2)25(3)34(27-13-7-4-8-14-27,28-15-9-5-10-16-28)29-17-11-6-12-18-29/h4-22,25H,1-3H3/q+1 |
| InChIKey | YGHSKTGMJJSIOH-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 524.46 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-bromo-6,7-dimethylnaphthalen-2-yl)ethyl-triphenylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-bromo-6,7-dimethylnaphthalen-2-yl)ethyl-triphenylphosphanium?
The IUPAC name of 1-(1-bromo-6,7-dimethylnaphthalen-2-yl)ethyl-triphenylphosphanium (CID 88627145) is 1-(1-bromo-6,7-dimethylnaphthalen-2-yl)ethyl-triphenylphosphanium.
What is the SMILES notation for 1-(1-bromo-6,7-dimethylnaphthalen-2-yl)ethyl-triphenylphosphanium?
The canonical SMILES for 1-(1-bromo-6,7-dimethylnaphthalen-2-yl)ethyl-triphenylphosphanium is Cc1cc2ccc(C(C)[P+](c3ccccc3)(c3ccccc3)c3ccccc3)c(Br)c2cc1C.
What is the InChIKey of 1-(1-bromo-6,7-dimethylnaphthalen-2-yl)ethyl-triphenylphosphanium?
The InChIKey is YGHSKTGMJJSIOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H29BrP/c1-23-21-26-19-20-30(32(33)31(26)22-24(23)2)25(3)34(27-13-7-4-8-14-27,28-15-9-5-10-16-28)29-17-11-6-12-18-29/h4-22,25H,1-3H3/q+1.
What are the key properties of 1-(1-bromo-6,7-dimethylnaphthalen-2-yl)ethyl-triphenylphosphanium?
1-(1-bromo-6,7-dimethylnaphthalen-2-yl)ethyl-triphenylphosphanium has a molecular weight of 524.46 g/mol, XLogP of 8.27, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-bromo-6,7-dimethylnaphthalen-2-yl)ethyl-triphenylphosphanium is sourced from PubChem (CID 88627145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).