C28H31NO3 — CID 88627802
2-ethyl-6-[N-hydroxy-C-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbonimidoyl]naphthalene-1-carboxylic acid (PubChem CID 88627802) has the molecular formula C28H31NO3 and a molecular weight of 429.56 g/mol. Its IUPAC name is 2-ethyl-6-[N-hydroxy-C-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbonimidoyl]naphthalene-1-carboxylic acid.
| Compound Name | 2-ethyl-6-[N-hydroxy-C-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbonimidoyl]naphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 88627802 |
| Molecular Formula | C28H31NO3 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | 2-ethyl-6-[N-hydroxy-C-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbonimidoyl]naphthalene-1-carboxylic acid |
| SMILES | CCc1ccc2cc(C(=NO)c3ccc4c(c3)C(C)(C)CCC4(C)C)ccc2c1C(=O)O |
| InChI | InChI=1S/C28H31NO3/c1-6-17-7-8-18-15-19(9-11-21(18)24(17)26(30)31)25(29-32)20-10-12-22-23(16-20)28(4,5)14-13-27(22,2)3/h7-12,15-16,32H,6,13-14H2,1-5H3,(H,30,31) |
| InChIKey | GAHPXPGPLFNPLX-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|