About dichloro(fluoro)methane;tetrafluoromethane
dichloro(fluoro)methane;tetrafluoromethane (PubChem CID 88628487) has the molecular formula C2HCl2F5
and a molecular weight of 190.93 g/mol. Its IUPAC name is dichloro(fluoro)methane;tetrafluoromethane.
Molecular Properties
| Compound Name | dichloro(fluoro)methane;tetrafluoromethane |
| PubChem CID | 88628487 |
| Molecular Formula | C2HCl2F5 |
| Molecular Weight | 190.93 g/mol |
| Exact Mass | 189.94 |
| IUPAC Name | dichloro(fluoro)methane;tetrafluoromethane |
| SMILES | FC(Cl)Cl.FC(F)(F)F |
| InChI | InChI=1S/CHCl2F.CF4/c2-1(3)4;2-1(3,4)5/h1H; |
| InChIKey | PEHGZEOYSWMTFB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.93 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze dichloro(fluoro)methane;tetrafluoromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloro(fluoro)methane;tetrafluoromethane?
The IUPAC name of dichloro(fluoro)methane;tetrafluoromethane (CID 88628487) is dichloro(fluoro)methane;tetrafluoromethane.
What is the SMILES notation for dichloro(fluoro)methane;tetrafluoromethane?
The canonical SMILES for dichloro(fluoro)methane;tetrafluoromethane is FC(Cl)Cl.FC(F)(F)F.
What is the InChIKey of dichloro(fluoro)methane;tetrafluoromethane?
The InChIKey is PEHGZEOYSWMTFB-UHFFFAOYSA-N. The full InChI is InChI=1S/CHCl2F.CF4/c2-1(3)4;2-1(3,4)5/h1H;.
What are the key properties of dichloro(fluoro)methane;tetrafluoromethane?
dichloro(fluoro)methane;tetrafluoromethane has a molecular weight of 190.93 g/mol, XLogP of 3.19, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichloro(fluoro)methane;tetrafluoromethane is sourced from PubChem (CID 88628487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).