About CID 88628527
CID 88628527 (PubChem CID 88628527) has the molecular formula C20H16N4O2Si
and a molecular weight of 372.46 g/mol.
Molecular Properties
| Compound Name | CID 88628527 |
| PubChem CID | 88628527 |
| Molecular Formula | C20H16N4O2Si |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | — |
| SMILES | C1=Cc2cc3ccc(cc4ccc(cc5nc(cc1n2)C=C5)[nH]4)[nH]3.O[Si]O |
| InChI | InChI=1S/C20H14N4.H2O2Si/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;1-3-2/h1-12,21-22H;1-2H/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-; |
| InChIKey | AXZRLLXNSBCMNS-QDJBTJTOSA-N |
| XLogP | 3.16 |
| TPSA | 97.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 88628527 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 88628527?
The IUPAC name of CID 88628527 (CID 88628527) is not available.
What is the SMILES notation for CID 88628527?
The canonical SMILES for CID 88628527 is C1=Cc2cc3ccc(cc4ccc(cc5nc(cc1n2)C=C5)[nH]4)[nH]3.O[Si]O.
What is the InChIKey of CID 88628527?
The InChIKey is AXZRLLXNSBCMNS-QDJBTJTOSA-N. The full InChI is InChI=1S/C20H14N4.H2O2Si/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;1-3-2/h1-12,21-22H;1-2H/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-;.
What are the key properties of CID 88628527?
CID 88628527 has a molecular weight of 372.46 g/mol, XLogP of 3.16, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 88628527 is sourced from PubChem (CID 88628527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).