C23H26O2 — CID 88630108
ethyl (2E,4E,6Z)-7-(3,7-dimethylnaphthalen-2-yl)-3-methylocta-2,4,6-trienoate (PubChem CID 88630108) has the molecular formula C23H26O2 and a molecular weight of 334.46 g/mol. Its IUPAC name is ethyl (2E,4E,6Z)-7-(3,7-dimethylnaphthalen-2-yl)-3-methylocta-2,4,6-trienoate.
| Compound Name | ethyl (2E,4E,6Z)-7-(3,7-dimethylnaphthalen-2-yl)-3-methylocta-2,4,6-trienoate |
|---|---|
| PubChem CID | 88630108 |
| Molecular Formula | C23H26O2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | ethyl (2E,4E,6Z)-7-(3,7-dimethylnaphthalen-2-yl)-3-methylocta-2,4,6-trienoate |
| SMILES | CCOC(=O)/C=C(C)/C=C/C=C(/C)c1cc2cc(C)ccc2cc1C |
| InChI | InChI=1S/C23H26O2/c1-6-25-23(24)13-16(2)8-7-9-18(4)22-15-21-12-17(3)10-11-20(21)14-19(22)5/h7-15H,6H2,1-5H3/b8-7+,16-13+,18-9- |
| InChIKey | MLFGRAVPWKORMC-SEMOGOOMSA-N |
| XLogP | 5.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|