C22H23N3O4 — CID 88630319
(4-methoxyphenyl)methyl (NE)-N-(1-phenyl-6-propoxypyridazin-4-ylidene)carbamate (PubChem CID 88630319) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl (NE)-N-(1-phenyl-6-propoxypyridazin-4-ylidene)carbamate.
| Compound Name | (4-methoxyphenyl)methyl (NE)-N-(1-phenyl-6-propoxypyridazin-4-ylidene)carbamate |
|---|---|
| PubChem CID | 88630319 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | (4-methoxyphenyl)methyl (NE)-N-(1-phenyl-6-propoxypyridazin-4-ylidene)carbamate |
| SMILES | CCCOc1c/c(=N\C(=O)OCc2ccc(OC)cc2)cnn1-c1ccccc1 |
| InChI | InChI=1S/C22H23N3O4/c1-3-13-28-21-14-18(15-23-25(21)19-7-5-4-6-8-19)24-22(26)29-16-17-9-11-20(27-2)12-10-17/h4-12,14-15H,3,13,16H2,1-2H3/b24-18+ |
| InChIKey | AQKVKLKESANSLE-HKOYGPOVSA-N |
| XLogP | 3.91 |
| TPSA | 74.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |