C13H19Cl2F3N6O2 — CID 88630998
methyl 5-imino-5-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]pentanoate;dihydrochloride (PubChem CID 88630998) has the molecular formula C13H19Cl2F3N6O2 and a molecular weight of 419.24 g/mol. Its IUPAC name is methyl 5-imino-5-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]pentanoate;dihydrochloride.
| Compound Name | methyl 5-imino-5-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]pentanoate;dihydrochloride |
|---|---|
| PubChem CID | 88630998 |
| Molecular Formula | C13H19Cl2F3N6O2 |
| Molecular Weight | 419.24 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | methyl 5-imino-5-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]pentanoate;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\CCCC(=O)OC)c1nccc(N/C(N)=N/CC(F)(F)F)n1 |
| InChI | InChI=1S/C13H17F3N6O2.2ClH/c1-24-10(23)4-2-3-8(17)11-19-6-5-9(21-11)22-12(18)20-7-13(14,15)16;;/h5-6,17H,2-4,7H2,1H3,(H3,18,19,20,21,22);2*1H/b17-8+;; |
| InChIKey | HHEOYOPGBSUPNI-JUEUMZLJSA-N |
| XLogP | 2.32 |
| TPSA | 126.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.24 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|