C16H19FN2O4 — CID 88631144
methyl (Z)-3-[(3R)-3-[(2,5-dioxo-3-prop-2-ynylimidazolidin-1-yl)methyl]-2,2-dimethylcyclopropyl]-2-fluoroprop-2-enoate (PubChem CID 88631144) has the molecular formula C16H19FN2O4 and a molecular weight of 322.34 g/mol. Its IUPAC name is methyl (Z)-3-[(3R)-3-[(2,5-dioxo-3-prop-2-ynylimidazolidin-1-yl)methyl]-2,2-dimethylcyclopropyl]-2-fluoroprop-2-enoate.
| Compound Name | methyl (Z)-3-[(3R)-3-[(2,5-dioxo-3-prop-2-ynylimidazolidin-1-yl)methyl]-2,2-dimethylcyclopropyl]-2-fluoroprop-2-enoate |
|---|---|
| PubChem CID | 88631144 |
| Molecular Formula | C16H19FN2O4 |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | methyl (Z)-3-[(3R)-3-[(2,5-dioxo-3-prop-2-ynylimidazolidin-1-yl)methyl]-2,2-dimethylcyclopropyl]-2-fluoroprop-2-enoate |
| SMILES | C#CCN1CC(=O)N(C[C@@H]2C(/C=C(\F)C(=O)OC)C2(C)C)C1=O |
| InChI | InChI=1S/C16H19FN2O4/c1-5-6-18-9-13(20)19(15(18)22)8-11-10(16(11,2)3)7-12(17)14(21)23-4/h1,7,10-11H,6,8-9H2,2-4H3/b12-7-/t10?,11-/m1/s1 |
| InChIKey | FGJQDNJOPOKRNJ-IRYYNKFGSA-N |
| XLogP | 1.18 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|