About (Z)-1-(3,5-dichlorophenyl)-N-methoxymethanimine
(Z)-1-(3,5-dichlorophenyl)-N-methoxymethanimine (PubChem CID 88631268) has the molecular formula C8H7Cl2NO
and a molecular weight of 204.06 g/mol. Its IUPAC name is (Z)-1-(3,5-dichlorophenyl)-N-methoxymethanimine.
Molecular Properties
| Compound Name | (Z)-1-(3,5-dichlorophenyl)-N-methoxymethanimine |
| PubChem CID | 88631268 |
| Molecular Formula | C8H7Cl2NO |
| Molecular Weight | 204.06 g/mol |
| Exact Mass | 202.99 |
| IUPAC Name | (Z)-1-(3,5-dichlorophenyl)-N-methoxymethanimine |
| SMILES | CO/N=C\c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C8H7Cl2NO/c1-12-11-5-6-2-7(9)4-8(10)3-6/h2-5H,1H3/b11-5- |
| InChIKey | UMRMZCPZXOQDFW-WZUFQYTHSA-N |
| XLogP | 2.97 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.06 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-(3,5-dichlorophenyl)-N-methoxymethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-(3,5-dichlorophenyl)-N-methoxymethanimine?
The IUPAC name of (Z)-1-(3,5-dichlorophenyl)-N-methoxymethanimine (CID 88631268) is (Z)-1-(3,5-dichlorophenyl)-N-methoxymethanimine.
What is the SMILES notation for (Z)-1-(3,5-dichlorophenyl)-N-methoxymethanimine?
The canonical SMILES for (Z)-1-(3,5-dichlorophenyl)-N-methoxymethanimine is CO/N=C\c1cc(Cl)cc(Cl)c1.
What is the InChIKey of (Z)-1-(3,5-dichlorophenyl)-N-methoxymethanimine?
The InChIKey is UMRMZCPZXOQDFW-WZUFQYTHSA-N. The full InChI is InChI=1S/C8H7Cl2NO/c1-12-11-5-6-2-7(9)4-8(10)3-6/h2-5H,1H3/b11-5-.
What are the key properties of (Z)-1-(3,5-dichlorophenyl)-N-methoxymethanimine?
(Z)-1-(3,5-dichlorophenyl)-N-methoxymethanimine has a molecular weight of 204.06 g/mol, XLogP of 2.97, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-(3,5-dichlorophenyl)-N-methoxymethanimine is sourced from PubChem (CID 88631268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).