C15H13ClN6S — CID 8863135
(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)prop-2-enenitrile (PubChem CID 8863135) has the molecular formula C15H13ClN6S and a molecular weight of 344.83 g/mol. Its IUPAC name is (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)prop-2-enenitrile.
| Compound Name | (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 8863135 |
| Molecular Formula | C15H13ClN6S |
| Molecular Weight | 344.83 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1c(Cl)nc2sccn12)c1nnc2n1CCCCC2 |
| InChI | InChI=1S/C15H13ClN6S/c16-13-11(21-6-7-23-15(21)18-13)8-10(9-17)14-20-19-12-4-2-1-3-5-22(12)14/h6-8H,1-5H2/b10-8+ |
| InChIKey | JRNIHGVQYRKZNN-CSKARUKUSA-N |
| XLogP | 3.43 |
| TPSA | 71.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.83 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|