About 1-[5-(4-fluorophenoxy)-1,3-dimethylpyrazol-4-yl]-N-(2-phenoxypropoxy)methanimine
1-[5-(4-fluorophenoxy)-1,3-dimethylpyrazol-4-yl]-N-(2-phenoxypropoxy)methanimine (PubChem CID 88631662) has the molecular formula C21H22FN3O3
and a molecular weight of 383.42 g/mol. Its IUPAC name is 1-[5-(4-fluorophenoxy)-1,3-dimethylpyrazol-4-yl]-N-(2-phenoxypropoxy)methanimine.
Molecular Properties
| Compound Name | 1-[5-(4-fluorophenoxy)-1,3-dimethylpyrazol-4-yl]-N-(2-phenoxypropoxy)methanimine |
| PubChem CID | 88631662 |
| Molecular Formula | C21H22FN3O3 |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 1-[5-(4-fluorophenoxy)-1,3-dimethylpyrazol-4-yl]-N-(2-phenoxypropoxy)methanimine |
| SMILES | Cc1nn(C)c(Oc2ccc(F)cc2)c1C=NOCC(C)Oc1ccccc1 |
| InChI | InChI=1S/C21H22FN3O3/c1-15(27-18-7-5-4-6-8-18)14-26-23-13-20-16(2)24-25(3)21(20)28-19-11-9-17(22)10-12-19/h4-13,15H,14H2,1-3H3 |
| InChIKey | OTVHQGAOZXOWAD-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 57.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[5-(4-fluorophenoxy)-1,3-dimethylpyrazol-4-yl]-N-(2-phenoxypropoxy)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(4-fluorophenoxy)-1,3-dimethylpyrazol-4-yl]-N-(2-phenoxypropoxy)methanimine?
The IUPAC name of 1-[5-(4-fluorophenoxy)-1,3-dimethylpyrazol-4-yl]-N-(2-phenoxypropoxy)methanimine (CID 88631662) is 1-[5-(4-fluorophenoxy)-1,3-dimethylpyrazol-4-yl]-N-(2-phenoxypropoxy)methanimine.
What is the SMILES notation for 1-[5-(4-fluorophenoxy)-1,3-dimethylpyrazol-4-yl]-N-(2-phenoxypropoxy)methanimine?
The canonical SMILES for 1-[5-(4-fluorophenoxy)-1,3-dimethylpyrazol-4-yl]-N-(2-phenoxypropoxy)methanimine is Cc1nn(C)c(Oc2ccc(F)cc2)c1C=NOCC(C)Oc1ccccc1.
What is the InChIKey of 1-[5-(4-fluorophenoxy)-1,3-dimethylpyrazol-4-yl]-N-(2-phenoxypropoxy)methanimine?
The InChIKey is OTVHQGAOZXOWAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22FN3O3/c1-15(27-18-7-5-4-6-8-18)14-26-23-13-20-16(2)24-25(3)21(20)28-19-11-9-17(22)10-12-19/h4-13,15H,14H2,1-3H3.
What are the key properties of 1-[5-(4-fluorophenoxy)-1,3-dimethylpyrazol-4-yl]-N-(2-phenoxypropoxy)methanimine?
1-[5-(4-fluorophenoxy)-1,3-dimethylpyrazol-4-yl]-N-(2-phenoxypropoxy)methanimine has a molecular weight of 383.42 g/mol, XLogP of 4.48, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(4-fluorophenoxy)-1,3-dimethylpyrazol-4-yl]-N-(2-phenoxypropoxy)methanimine is sourced from PubChem (CID 88631662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).