C25H31NO6 — CID 88631725
tert-butyl N-hexanoyl-N-(2,5,9-trimethyl-7-oxofuro[3,2-g]chromen-3-yl)carbamate (PubChem CID 88631725) has the molecular formula C25H31NO6 and a molecular weight of 441.52 g/mol. Its IUPAC name is tert-butyl N-hexanoyl-N-(2,5,9-trimethyl-7-oxofuro[3,2-g]chromen-3-yl)carbamate.
| Compound Name | tert-butyl N-hexanoyl-N-(2,5,9-trimethyl-7-oxofuro[3,2-g]chromen-3-yl)carbamate |
|---|---|
| PubChem CID | 88631725 |
| Molecular Formula | C25H31NO6 |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | tert-butyl N-hexanoyl-N-(2,5,9-trimethyl-7-oxofuro[3,2-g]chromen-3-yl)carbamate |
| SMILES | CCCCCC(=O)N(C(=O)OC(C)(C)C)c1c(C)oc2c(C)c3oc(=O)cc(C)c3cc12 |
| InChI | InChI=1S/C25H31NO6/c1-8-9-10-11-19(27)26(24(29)32-25(5,6)7)21-16(4)30-23-15(3)22-17(13-18(21)23)14(2)12-20(28)31-22/h12-13H,8-11H2,1-7H3 |
| InChIKey | HJAPBJDSDYUFNW-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 89.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|