About 2-methoxy-3-(3-methoxy-2,3-dimethylbutan-2-yl)oxy-2,3-dimethylbutane
2-methoxy-3-(3-methoxy-2,3-dimethylbutan-2-yl)oxy-2,3-dimethylbutane (PubChem CID 88631923) has the molecular formula C14H30O3
and a molecular weight of 246.39 g/mol. Its IUPAC name is 2-methoxy-3-(3-methoxy-2,3-dimethylbutan-2-yl)oxy-2,3-dimethylbutane.
Molecular Properties
| Compound Name | 2-methoxy-3-(3-methoxy-2,3-dimethylbutan-2-yl)oxy-2,3-dimethylbutane |
| PubChem CID | 88631923 |
| Molecular Formula | C14H30O3 |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.22 |
| IUPAC Name | 2-methoxy-3-(3-methoxy-2,3-dimethylbutan-2-yl)oxy-2,3-dimethylbutane |
| SMILES | COC(C)(C)C(C)(C)OC(C)(C)C(C)(C)OC |
| InChI | InChI=1S/C14H30O3/c1-11(2,15-9)13(5,6)17-14(7,8)12(3,4)16-10/h1-10H3 |
| InChIKey | LXENFHHSRTVZSK-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methoxy-3-(3-methoxy-2,3-dimethylbutan-2-yl)oxy-2,3-dimethylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-3-(3-methoxy-2,3-dimethylbutan-2-yl)oxy-2,3-dimethylbutane?
The IUPAC name of 2-methoxy-3-(3-methoxy-2,3-dimethylbutan-2-yl)oxy-2,3-dimethylbutane (CID 88631923) is 2-methoxy-3-(3-methoxy-2,3-dimethylbutan-2-yl)oxy-2,3-dimethylbutane.
What is the SMILES notation for 2-methoxy-3-(3-methoxy-2,3-dimethylbutan-2-yl)oxy-2,3-dimethylbutane?
The canonical SMILES for 2-methoxy-3-(3-methoxy-2,3-dimethylbutan-2-yl)oxy-2,3-dimethylbutane is COC(C)(C)C(C)(C)OC(C)(C)C(C)(C)OC.
What is the InChIKey of 2-methoxy-3-(3-methoxy-2,3-dimethylbutan-2-yl)oxy-2,3-dimethylbutane?
The InChIKey is LXENFHHSRTVZSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30O3/c1-11(2,15-9)13(5,6)17-14(7,8)12(3,4)16-10/h1-10H3.
What are the key properties of 2-methoxy-3-(3-methoxy-2,3-dimethylbutan-2-yl)oxy-2,3-dimethylbutane?
2-methoxy-3-(3-methoxy-2,3-dimethylbutan-2-yl)oxy-2,3-dimethylbutane has a molecular weight of 246.39 g/mol, XLogP of 3.41, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-3-(3-methoxy-2,3-dimethylbutan-2-yl)oxy-2,3-dimethylbutane is sourced from PubChem (CID 88631923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).