C17H9F17O5 — CID 88632625
3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecan-2-yl 3,4,5-trihydroxybenzoate (PubChem CID 88632625) has the molecular formula C17H9F17O5 and a molecular weight of 616.22 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecan-2-yl 3,4,5-trihydroxybenzoate.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecan-2-yl 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 88632625 |
| Molecular Formula | C17H9F17O5 |
| Molecular Weight | 616.22 g/mol |
| Exact Mass | 616.02 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecan-2-yl 3,4,5-trihydroxybenzoate |
| SMILES | CC(OC(=O)c1cc(O)c(O)c(O)c1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H9F17O5/c1-4(39-9(38)5-2-6(35)8(37)7(36)3-5)10(18,19)11(20,21)12(22,23)13(24,25)14(26,27)15(28,29)16(30,31)17(32,33)34/h2-4,35-37H,1H3 |
| InChIKey | ZTOBUAZOGFJJGZ-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.22 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|