About 3-butyl-6-hydroxy-1-(7-oxabicyclo[4.1.0]hepta-2,4-dien-1-yl)heptan-1-one
3-butyl-6-hydroxy-1-(7-oxabicyclo[4.1.0]hepta-2,4-dien-1-yl)heptan-1-one (PubChem CID 88632676) has the molecular formula C17H26O3
and a molecular weight of 278.39 g/mol. Its IUPAC name is 3-butyl-6-hydroxy-1-(7-oxabicyclo[4.1.0]hepta-2,4-dien-1-yl)heptan-1-one.
Molecular Properties
| Compound Name | 3-butyl-6-hydroxy-1-(7-oxabicyclo[4.1.0]hepta-2,4-dien-1-yl)heptan-1-one |
| PubChem CID | 88632676 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 3-butyl-6-hydroxy-1-(7-oxabicyclo[4.1.0]hepta-2,4-dien-1-yl)heptan-1-one |
| SMILES | CCCCC(CCC(C)O)CC(=O)C12C=CC=CC1O2 |
| InChI | InChI=1S/C17H26O3/c1-3-4-7-14(10-9-13(2)18)12-15(19)17-11-6-5-8-16(17)20-17/h5-6,8,11,13-14,16,18H,3-4,7,9-10,12H2,1-2H3 |
| InChIKey | JLDCOQNRGKRTIM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-butyl-6-hydroxy-1-(7-oxabicyclo[4.1.0]hepta-2,4-dien-1-yl)heptan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-6-hydroxy-1-(7-oxabicyclo[4.1.0]hepta-2,4-dien-1-yl)heptan-1-one?
The IUPAC name of 3-butyl-6-hydroxy-1-(7-oxabicyclo[4.1.0]hepta-2,4-dien-1-yl)heptan-1-one (CID 88632676) is 3-butyl-6-hydroxy-1-(7-oxabicyclo[4.1.0]hepta-2,4-dien-1-yl)heptan-1-one.
What is the SMILES notation for 3-butyl-6-hydroxy-1-(7-oxabicyclo[4.1.0]hepta-2,4-dien-1-yl)heptan-1-one?
The canonical SMILES for 3-butyl-6-hydroxy-1-(7-oxabicyclo[4.1.0]hepta-2,4-dien-1-yl)heptan-1-one is CCCCC(CCC(C)O)CC(=O)C12C=CC=CC1O2.
What is the InChIKey of 3-butyl-6-hydroxy-1-(7-oxabicyclo[4.1.0]hepta-2,4-dien-1-yl)heptan-1-one?
The InChIKey is JLDCOQNRGKRTIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26O3/c1-3-4-7-14(10-9-13(2)18)12-15(19)17-11-6-5-8-16(17)20-17/h5-6,8,11,13-14,16,18H,3-4,7,9-10,12H2,1-2H3.
What are the key properties of 3-butyl-6-hydroxy-1-(7-oxabicyclo[4.1.0]hepta-2,4-dien-1-yl)heptan-1-one?
3-butyl-6-hydroxy-1-(7-oxabicyclo[4.1.0]hepta-2,4-dien-1-yl)heptan-1-one has a molecular weight of 278.39 g/mol, XLogP of 3.18, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-6-hydroxy-1-(7-oxabicyclo[4.1.0]hepta-2,4-dien-1-yl)heptan-1-one is sourced from PubChem (CID 88632676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).